C11H15ClN+ — CID 7022801
(2S)-2-[(3-chlorophenyl)methyl]pyrrolidin-1-ium (PubChem CID 7022801) has the molecular formula C11H15ClN+ and a molecular weight of 196.70 g/mol. Its IUPAC name is (2S)-2-[(3-chlorophenyl)methyl]pyrrolidin-1-ium.
| Compound Name | (2S)-2-[(3-chlorophenyl)methyl]pyrrolidin-1-ium |
|---|---|
| PubChem CID | 7022801 |
| Molecular Formula | C11H15ClN+ |
| Molecular Weight | 196.70 g/mol |
| Exact Mass | 196.09 |
| IUPAC Name | (2S)-2-[(3-chlorophenyl)methyl]pyrrolidin-1-ium |
| SMILES | Clc1cccc(C[C@@H]2CCC[NH2+]2)c1 |
| InChI | InChI=1S/C11H14ClN/c12-10-4-1-3-9(7-10)8-11-5-2-6-13-11/h1,3-4,7,11,13H,2,5-6,8H2/p+1/t11-/m0/s1 |
| InChIKey | QUAHLSVNDCUURH-NSHDSACASA-O |
| XLogP | 1.61 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.70 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |