C11H14ClN — CID 130877387
N-[(3-chlorophenyl)methyl]-N-methylcyclopropanamine (PubChem CID 130877387) has the molecular formula C11H14ClN and a molecular weight of 195.69 g/mol. Its IUPAC name is N-[(3-chlorophenyl)methyl]-N-methylcyclopropanamine.
| Compound Name | N-[(3-chlorophenyl)methyl]-N-methylcyclopropanamine |
|---|---|
| PubChem CID | 130877387 |
| Molecular Formula | C11H14ClN |
| Molecular Weight | 195.69 g/mol |
| Exact Mass | 195.08 |
| IUPAC Name | N-[(3-chlorophenyl)methyl]-N-methylcyclopropanamine |
| SMILES | CN(Cc1cccc(Cl)c1)C1CC1 |
| InChI | InChI=1S/C11H14ClN/c1-13(11-5-6-11)8-9-3-2-4-10(12)7-9/h2-4,7,11H,5-6,8H2,1H3 |
| InChIKey | GWODBSVYMMOXNH-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.69 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |