C12H16ClNO3S — CID 129366382
(3R,4R)-4-[(3-chlorophenyl)methyl-methylamino]-1,1-dioxothiolan-3-ol (PubChem CID 129366382) has the molecular formula C12H16ClNO3S and a molecular weight of 289.78 g/mol. Its IUPAC name is (3R,4R)-4-[(3-chlorophenyl)methyl-methylamino]-1,1-dioxothiolan-3-ol.
| Compound Name | (3R,4R)-4-[(3-chlorophenyl)methyl-methylamino]-1,1-dioxothiolan-3-ol |
|---|---|
| PubChem CID | 129366382 |
| Molecular Formula | C12H16ClNO3S |
| Molecular Weight | 289.78 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | (3R,4R)-4-[(3-chlorophenyl)methyl-methylamino]-1,1-dioxothiolan-3-ol |
| SMILES | CN(Cc1cccc(Cl)c1)[C@H]1CS(=O)(=O)C[C@@H]1O |
| InChI | InChI=1S/C12H16ClNO3S/c1-14(6-9-3-2-4-10(13)5-9)11-7-18(16,17)8-12(11)15/h2-5,11-12,15H,6-8H2,1H3/t11-,12-/m0/s1 |
| InChIKey | IVFACUHUWGVKFS-RYUDHWBXSA-N |
| XLogP | 0.93 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.78 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |