C17H26ClN3O2S — CID 119139947
1-[(3-chlorophenyl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methyl-3-propan-2-ylguanidine (PubChem CID 119139947) has the molecular formula C17H26ClN3O2S and a molecular weight of 371.93 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methyl-3-propan-2-ylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methyl-3-propan-2-ylguanidine |
|---|---|
| PubChem CID | 119139947 |
| Molecular Formula | C17H26ClN3O2S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-1-methyl-3-propan-2-ylguanidine |
| SMILES | CC(C)N/C(=N\CC1CCS(=O)(=O)C1)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H26ClN3O2S/c1-13(2)20-17(19-10-15-7-8-24(22,23)12-15)21(3)11-14-5-4-6-16(18)9-14/h4-6,9,13,15H,7-8,10-12H2,1-3H3,(H,19,20) |
| InChIKey | YKIPKKZUAAWFIT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|