C16H24ClN3O2S — CID 111305723
1-[(3-chlorophenyl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-1-methylguanidine (PubChem CID 111305723) has the molecular formula C16H24ClN3O2S and a molecular weight of 357.91 g/mol. Its IUPAC name is 1-[(3-chlorophenyl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-1-methylguanidine.
| Compound Name | 1-[(3-chlorophenyl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-1-methylguanidine |
|---|---|
| PubChem CID | 111305723 |
| Molecular Formula | C16H24ClN3O2S |
| Molecular Weight | 357.91 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 1-[(3-chlorophenyl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-1-methylguanidine |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H24ClN3O2S/c1-3-18-16(19-10-14-7-8-23(21,22)12-14)20(2)11-13-5-4-6-15(17)9-13/h4-6,9,14H,3,7-8,10-12H2,1-2H3,(H,18,19) |
| InChIKey | DGMBUEFVPYYGME-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.91 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|