C14H23ClIN3O2S2 — CID 119132909
1-[(5-chlorothiophen-2-yl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide (PubChem CID 119132909) has the molecular formula C14H23ClIN3O2S2 and a molecular weight of 491.85 g/mol. Its IUPAC name is 1-[(5-chlorothiophen-2-yl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide.
| Compound Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 119132909 |
| Molecular Formula | C14H23ClIN3O2S2 |
| Molecular Weight | 491.85 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 1-[(5-chlorothiophen-2-yl)methyl]-2-[(1,1-dioxothiolan-3-yl)methyl]-3-ethyl-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)N(C)Cc1ccc(Cl)s1.I |
| InChI | InChI=1S/C14H22ClN3O2S2.HI/c1-3-16-14(17-8-11-6-7-22(19,20)10-11)18(2)9-12-4-5-13(15)21-12;/h4-5,11H,3,6-10H2,1-2H3,(H,16,17);1H |
| InChIKey | XIZGIGNBPNAVPO-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.85 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|