C14H24IN3O3S — CID 111354873
2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111354873) has the molecular formula C14H24IN3O3S and a molecular weight of 441.34 g/mol. Its IUPAC name is 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111354873 |
| Molecular Formula | C14H24IN3O3S |
| Molecular Weight | 441.34 g/mol |
| Exact Mass | 441.06 |
| IUPAC Name | 2-[(1,1-dioxothiolan-3-yl)methyl]-1-ethyl-3-[2-(furan-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CCS(=O)(=O)C1)NCCc1ccco1.I |
| InChI | InChI=1S/C14H23N3O3S.HI/c1-2-15-14(16-7-5-13-4-3-8-20-13)17-10-12-6-9-21(18,19)11-12;/h3-4,8,12H,2,5-7,9-11H2,1H3,(H2,15,16,17);1H |
| InChIKey | GZQAHHISWJQFRD-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.34 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|