C14H23N3O3S — CID 111766749
1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]-2-propylguanidine (PubChem CID 111766749) has the molecular formula C14H23N3O3S and a molecular weight of 313.42 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]-2-propylguanidine.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]-2-propylguanidine |
|---|---|
| PubChem CID | 111766749 |
| Molecular Formula | C14H23N3O3S |
| Molecular Weight | 313.42 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]-2-propylguanidine |
| SMILES | CCC/N=C(\NCCc1ccco1)NC1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C14H23N3O3S/c1-2-7-15-14(16-8-5-13-4-3-9-20-13)17-12-6-10-21(18,19)11-12/h3-4,9,12H,2,5-8,10-11H2,1H3,(H2,15,16,17) |
| InChIKey | HQLIOAHUMSCHPT-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 83.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.42 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|