C15H25N3OS — CID 110056760
1-[2-(furan-2-yl)ethyl]-2-propyl-3-(thian-3-yl)guanidine (PubChem CID 110056760) has the molecular formula C15H25N3OS and a molecular weight of 295.45 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-2-propyl-3-(thian-3-yl)guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-2-propyl-3-(thian-3-yl)guanidine |
|---|---|
| PubChem CID | 110056760 |
| Molecular Formula | C15H25N3OS |
| Molecular Weight | 295.45 g/mol |
| Exact Mass | 295.17 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-2-propyl-3-(thian-3-yl)guanidine |
| SMILES | CCC/N=C(\NCCc1ccco1)NC1CCCSC1 |
| InChI | InChI=1S/C15H25N3OS/c1-2-8-16-15(18-13-5-4-11-20-12-13)17-9-7-14-6-3-10-19-14/h3,6,10,13H,2,4-5,7-9,11-12H2,1H3,(H2,16,17,18) |
| InChIKey | WRMPLIGJRQKAGV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.45 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|