C20H32N4O3S — CID 110056772
ethyl 4-[[N'-[2-(furan-2-yl)ethyl]-N-(thian-3-yl)carbamimidoyl]amino]piperidine-1-carboxylate (PubChem CID 110056772) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is ethyl 4-[[N'-[2-(furan-2-yl)ethyl]-N-(thian-3-yl)carbamimidoyl]amino]piperidine-1-carboxylate.
| Compound Name | ethyl 4-[[N'-[2-(furan-2-yl)ethyl]-N-(thian-3-yl)carbamimidoyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 110056772 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | ethyl 4-[[N'-[2-(furan-2-yl)ethyl]-N-(thian-3-yl)carbamimidoyl]amino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)N1CCC(N/C(=N/CCc2ccco2)NC2CCCSC2)CC1 |
| InChI | InChI=1S/C20H32N4O3S/c1-2-26-20(25)24-11-8-16(9-12-24)22-19(23-17-5-4-14-28-15-17)21-10-7-18-6-3-13-27-18/h3,6,13,16-17H,2,4-5,7-12,14-15H2,1H3,(H2,21,22,23) |
| InChIKey | VIOOPCCRXLZZRA-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|