C19H31IN4O3 — CID 110053361
ethyl 4-[N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide (PubChem CID 110053361) has the molecular formula C19H31IN4O3 and a molecular weight of 490.39 g/mol. Its IUPAC name is ethyl 4-[N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide.
| Compound Name | ethyl 4-[N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110053361 |
| Molecular Formula | C19H31IN4O3 |
| Molecular Weight | 490.39 g/mol |
| Exact Mass | 490.14 |
| IUPAC Name | ethyl 4-[N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]piperazine-1-carboxylate;hydroiodide |
| SMILES | CCOC(=O)N1CCN(/C(=N\CCc2ccco2)NC2CCCC2)CC1.I |
| InChI | InChI=1S/C19H30N4O3.HI/c1-2-25-19(24)23-13-11-22(12-14-23)18(21-16-6-3-4-7-16)20-10-9-17-8-5-15-26-17;/h5,8,15-16H,2-4,6-7,9-14H2,1H3,(H,20,21);1H |
| InChIKey | LZQIAPGPJXYLJP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|