C19H28N6O — CID 110057464
N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]-4-(1H-1,2,4-triazol-5-yl)piperidine-1-carboximidamide (PubChem CID 110057464) has the molecular formula C19H28N6O and a molecular weight of 356.47 g/mol. Its IUPAC name is N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]-4-(1H-1,2,4-triazol-5-yl)piperidine-1-carboximidamide.
| Compound Name | N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]-4-(1H-1,2,4-triazol-5-yl)piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 110057464 |
| Molecular Formula | C19H28N6O |
| Molecular Weight | 356.47 g/mol |
| Exact Mass | 356.23 |
| IUPAC Name | N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]-4-(1H-1,2,4-triazol-5-yl)piperidine-1-carboximidamide |
| SMILES | c1coc(CC/N=C(/NC2CCCC2)N2CCC(c3ncn[nH]3)CC2)c1 |
| InChI | InChI=1S/C19H28N6O/c1-2-5-16(4-1)23-19(20-10-7-17-6-3-13-26-17)25-11-8-15(9-12-25)18-21-14-22-24-18/h3,6,13-16H,1-2,4-5,7-12H2,(H,20,23)(H,21,22,24) |
| InChIKey | HYCOXNCFYQLKNQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 82.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.47 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|