C20H32IN3O3 — CID 110053251
ethyl 1-[N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide (PubChem CID 110053251) has the molecular formula C20H32IN3O3 and a molecular weight of 489.40 g/mol. Its IUPAC name is ethyl 1-[N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide.
| Compound Name | ethyl 1-[N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
|---|---|
| PubChem CID | 110053251 |
| Molecular Formula | C20H32IN3O3 |
| Molecular Weight | 489.40 g/mol |
| Exact Mass | 489.15 |
| IUPAC Name | ethyl 1-[N-cyclopentyl-N'-[2-(furan-2-yl)ethyl]carbamimidoyl]piperidine-3-carboxylate;hydroiodide |
| SMILES | CCOC(=O)C1CCCN(/C(=N\CCc2ccco2)NC2CCCC2)C1.I |
| InChI | InChI=1S/C20H31N3O3.HI/c1-2-25-19(24)16-7-5-13-23(15-16)20(22-17-8-3-4-9-17)21-12-11-18-10-6-14-26-18;/h6,10,14,16-17H,2-5,7-9,11-13,15H2,1H3,(H,21,22);1H |
| InChIKey | GQKNOAVSRJMEKL-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.40 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|