C20H28N3O5+ — CID 8842192
[2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-2-oxoethyl]-bis(furan-2-ylmethyl)azanium (PubChem CID 8842192) has the molecular formula C20H28N3O5+ and a molecular weight of 390.46 g/mol. Its IUPAC name is [2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-2-oxoethyl]-bis(furan-2-ylmethyl)azanium.
| Compound Name | [2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-2-oxoethyl]-bis(furan-2-ylmethyl)azanium |
|---|---|
| PubChem CID | 8842192 |
| Molecular Formula | C20H28N3O5+ |
| Molecular Weight | 390.46 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | [2-[(1-ethoxycarbonylpiperidin-4-yl)amino]-2-oxoethyl]-bis(furan-2-ylmethyl)azanium |
| SMILES | CCOC(=O)N1CCC(NC(=O)C[NH+](Cc2ccco2)Cc2ccco2)CC1 |
| InChI | InChI=1S/C20H27N3O5/c1-2-26-20(25)23-9-7-16(8-10-23)21-19(24)15-22(13-17-5-3-11-27-17)14-18-6-4-12-28-18/h3-6,11-12,16H,2,7-10,13-15H2,1H3,(H,21,24)/p+1 |
| InChIKey | MCVOVMHTFOYCGK-UHFFFAOYSA-O |
| XLogP | 1.19 |
| TPSA | 89.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.46 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |