C18H25IN4O5S2 — CID 111141706
1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111141706) has the molecular formula C18H25IN4O5S2 and a molecular weight of 568.46 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111141706 |
| Molecular Formula | C18H25IN4O5S2 |
| Molecular Weight | 568.46 g/mol |
| Exact Mass | 568.03 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | I.NS(=O)(=O)c1ccc(C/N=C(\NCCc2ccco2)NC2CCS(=O)(=O)C2)cc1 |
| InChI | InChI=1S/C18H24N4O5S2.HI/c19-29(25,26)17-5-3-14(4-6-17)12-21-18(20-9-7-16-2-1-10-27-16)22-15-8-11-28(23,24)13-15;/h1-6,10,15H,7-9,11-13H2,(H2,19,25,26)(H2,20,21,22);1H |
| InChIKey | OSCNGEHPDDURJZ-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 143.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.46 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|