C22H31IN4O3S — CID 110057091
N-[2-(furan-2-yl)ethyl]-N'-[(4-sulfamoylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide (PubChem CID 110057091) has the molecular formula C22H31IN4O3S and a molecular weight of 558.49 g/mol. Its IUPAC name is N-[2-(furan-2-yl)ethyl]-N'-[(4-sulfamoylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide.
| Compound Name | N-[2-(furan-2-yl)ethyl]-N'-[(4-sulfamoylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 110057091 |
| Molecular Formula | C22H31IN4O3S |
| Molecular Weight | 558.49 g/mol |
| Exact Mass | 558.12 |
| IUPAC Name | N-[2-(furan-2-yl)ethyl]-N'-[(4-sulfamoylphenyl)methyl]-1,3,3a,4,5,6,7,7a-octahydroisoindole-2-carboximidamide;hydroiodide |
| SMILES | I.NS(=O)(=O)c1ccc(C/N=C(\NCCc2ccco2)N2CC3CCCCC3C2)cc1 |
| InChI | InChI=1S/C22H30N4O3S.HI/c23-30(27,28)21-9-7-17(8-10-21)14-25-22(24-12-11-20-6-3-13-29-20)26-15-18-4-1-2-5-19(18)16-26;/h3,6-10,13,18-19H,1-2,4-5,11-12,14-16H2,(H,24,25)(H2,23,27,28);1H |
| InChIKey | LYJWXMNTJGFFEP-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 100.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.49 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|