C22H33IN4O3S — CID 110056097
1-(3-ethylcyclohexyl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 110056097) has the molecular formula C22H33IN4O3S and a molecular weight of 560.50 g/mol. Its IUPAC name is 1-(3-ethylcyclohexyl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethylcyclohexyl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 110056097 |
| Molecular Formula | C22H33IN4O3S |
| Molecular Weight | 560.50 g/mol |
| Exact Mass | 560.13 |
| IUPAC Name | 1-(3-ethylcyclohexyl)-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCC1CCCC(N/C(=N/Cc2ccc(S(N)(=O)=O)cc2)NCCc2ccco2)C1.I |
| InChI | InChI=1S/C22H32N4O3S.HI/c1-2-17-5-3-6-19(15-17)26-22(24-13-12-20-7-4-14-29-20)25-16-18-8-10-21(11-9-18)30(23,27)28;/h4,7-11,14,17,19H,2-3,5-6,12-13,15-16H2,1H3,(H2,23,27,28)(H2,24,25,26);1H |
| InChIKey | RMSDNICUDIBENI-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.50 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|