C20H28N4O4S — CID 110058488
1-[2-(furan-2-yl)ethyl]-3-[(2-methyloxolan-2-yl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine (PubChem CID 110058488) has the molecular formula C20H28N4O4S and a molecular weight of 420.54 g/mol. Its IUPAC name is 1-[2-(furan-2-yl)ethyl]-3-[(2-methyloxolan-2-yl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine.
| Compound Name | 1-[2-(furan-2-yl)ethyl]-3-[(2-methyloxolan-2-yl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 110058488 |
| Molecular Formula | C20H28N4O4S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 1-[2-(furan-2-yl)ethyl]-3-[(2-methyloxolan-2-yl)methyl]-2-[(4-sulfamoylphenyl)methyl]guanidine |
| SMILES | CC1(CN/C(=N/Cc2ccc(S(N)(=O)=O)cc2)NCCc2ccco2)CCCO1 |
| InChI | InChI=1S/C20H28N4O4S/c1-20(10-3-13-28-20)15-24-19(22-11-9-17-4-2-12-27-17)23-14-16-5-7-18(8-6-16)29(21,25)26/h2,4-8,12H,3,9-11,13-15H2,1H3,(H2,21,25,26)(H2,22,23,24) |
| InChIKey | UWVDJUOQPHBSAT-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 118.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|