C21H24FIN4O3S — CID 111233478
1-[(4-fluorophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111233478) has the molecular formula C21H24FIN4O3S and a molecular weight of 558.42 g/mol. Its IUPAC name is 1-[(4-fluorophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(4-fluorophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111233478 |
| Molecular Formula | C21H24FIN4O3S |
| Molecular Weight | 558.42 g/mol |
| Exact Mass | 558.06 |
| IUPAC Name | 1-[(4-fluorophenyl)methyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | I.NS(=O)(=O)c1ccc(C/N=C(\NCCc2ccco2)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C21H23FN4O3S.HI/c22-18-7-3-16(4-8-18)14-25-21(24-12-11-19-2-1-13-29-19)26-15-17-5-9-20(10-6-17)30(23,27)28;/h1-10,13H,11-12,14-15H2,(H2,23,27,28)(H2,24,25,26);1H |
| InChIKey | YCNIMIRKQSFASP-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 109.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|