C20H26IN5O3S2 — CID 111516788
1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide (PubChem CID 111516788) has the molecular formula C20H26IN5O3S2 and a molecular weight of 575.50 g/mol. Its IUPAC name is 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111516788 |
| Molecular Formula | C20H26IN5O3S2 |
| Molecular Weight | 575.50 g/mol |
| Exact Mass | 575.05 |
| IUPAC Name | 1-[(5-ethyl-1,3-thiazol-2-yl)methyl]-3-[2-(furan-2-yl)ethyl]-2-[(4-sulfamoylphenyl)methyl]guanidine;hydroiodide |
| SMILES | CCc1cnc(CN/C(=N/Cc2ccc(S(N)(=O)=O)cc2)NCCc2ccco2)s1.I |
| InChI | InChI=1S/C20H25N5O3S2.HI/c1-2-17-13-23-19(29-17)14-25-20(22-10-9-16-4-3-11-28-16)24-12-15-5-7-18(8-6-15)30(21,26)27;/h3-8,11,13H,2,9-10,12,14H2,1H3,(H2,21,26,27)(H2,22,24,25);1H |
| InChIKey | OJVWHNHMDNDMBS-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 122.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.50 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|