C18H27N5O2S2 — CID 111535016
2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111535016) has the molecular formula C18H27N5O2S2 and a molecular weight of 409.58 g/mol. Its IUPAC name is 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111535016 |
| Molecular Formula | C18H27N5O2S2 |
| Molecular Weight | 409.58 g/mol |
| Exact Mass | 409.16 |
| IUPAC Name | 2-[[4-(dimethylsulfamoyl)phenyl]methyl]-1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(=O)(=O)N(C)C)cc1)NCc1ncc(CC)s1 |
| InChI | InChI=1S/C18H27N5O2S2/c1-5-15-12-20-17(26-15)13-22-18(19-6-2)21-11-14-7-9-16(10-8-14)27(24,25)23(3)4/h7-10,12H,5-6,11,13H2,1-4H3,(H2,19,21,22) |
| InChIKey | BGEJUPIIENHDSO-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.58 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|