C13H23N5OS — CID 111517398
2-[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide (PubChem CID 111517398) has the molecular formula C13H23N5OS and a molecular weight of 297.43 g/mol. Its IUPAC name is 2-[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 111517398 |
| Molecular Formula | C13H23N5OS |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | 2-[[ethylamino-[(5-ethyl-1,3-thiazol-2-yl)methylamino]methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCc1ncc(CC)s1 |
| InChI | InChI=1S/C13H23N5OS/c1-5-10-7-15-11(20-10)8-16-13(14-6-2)17-9-12(19)18(3)4/h7H,5-6,8-9H2,1-4H3,(H2,14,16,17) |
| InChIKey | DHZPWHNJSIYMFJ-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|