C13H24IN5OS — CID 111796881
2-[[ethylamino-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111796881) has the molecular formula C13H24IN5OS and a molecular weight of 425.34 g/mol. Its IUPAC name is 2-[[ethylamino-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[ethylamino-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111796881 |
| Molecular Formula | C13H24IN5OS |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 425.07 |
| IUPAC Name | 2-[[ethylamino-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N(C)C)NCCc1ncc(C)s1.I |
| InChI | InChI=1S/C13H23N5OS.HI/c1-5-14-13(17-9-12(19)18(3)4)15-7-6-11-16-8-10(2)20-11;/h8H,5-7,9H2,1-4H3,(H2,14,15,17);1H |
| InChIKey | BNQPPMWOKNKPFT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|