C15H25N5OS — CID 111796857
N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]acetamide (PubChem CID 111796857) has the molecular formula C15H25N5OS and a molecular weight of 323.47 g/mol. Its IUPAC name is N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111796857 |
| Molecular Formula | C15H25N5OS |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.18 |
| IUPAC Name | N,N-dimethyl-2-[[(2-methylprop-2-enylamino)-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]acetamide |
| SMILES | C=C(C)CN/C(=N\CC(=O)N(C)C)NCCc1ncc(C)s1 |
| InChI | InChI=1S/C15H25N5OS/c1-11(2)8-18-15(19-10-14(21)20(4)5)16-7-6-13-17-9-12(3)22-13/h9H,1,6-8,10H2,2-5H3,(H2,16,18,19) |
| InChIKey | MYAIXAWMGUSVBY-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|