C15H27N5OS — CID 111797374
N-tert-butyl-2-[[ethylamino-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]acetamide (PubChem CID 111797374) has the molecular formula C15H27N5OS and a molecular weight of 325.48 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111797374 |
| Molecular Formula | C15H27N5OS |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[2-(5-methyl-1,3-thiazol-2-yl)ethylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCc1ncc(C)s1 |
| InChI | InChI=1S/C15H27N5OS/c1-6-16-14(19-10-12(21)20-15(3,4)5)17-8-7-13-18-9-11(2)22-13/h9H,6-8,10H2,1-5H3,(H,20,21)(H2,16,17,19) |
| InChIKey | VNCHJTQUHWSPMX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 78.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|