C14H26N6O2 — CID 111384789
N-tert-butyl-2-[[ethylamino-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methylidene]amino]acetamide (PubChem CID 111384789) has the molecular formula C14H26N6O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-tert-butyl-2-[[ethylamino-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methylidene]amino]acetamide.
| Compound Name | N-tert-butyl-2-[[ethylamino-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methylidene]amino]acetamide |
|---|---|
| PubChem CID | 111384789 |
| Molecular Formula | C14H26N6O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | N-tert-butyl-2-[[ethylamino-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethylamino]methylidene]amino]acetamide |
| SMILES | CCN/C(=N\CC(=O)NC(C)(C)C)NCCc1nc(C)no1 |
| InChI | InChI=1S/C14H26N6O2/c1-6-15-13(17-9-11(21)19-14(3,4)5)16-8-7-12-18-10(2)20-22-12/h6-9H2,1-5H3,(H,19,21)(H2,15,16,17) |
| InChIKey | AVQGASOHCCHGDB-UHFFFAOYSA-N |
| XLogP | 0.39 |
| TPSA | 104.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|