C14H24N6O2 — CID 111930035
1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine (PubChem CID 111930035) has the molecular formula C14H24N6O2 and a molecular weight of 308.39 g/mol. Its IUPAC name is 1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 111930035 |
| Molecular Formula | C14H24N6O2 |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | 1-ethyl-3-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-2-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(=O)N1CCCC1)NCCc1nc(C)no1 |
| InChI | InChI=1S/C14H24N6O2/c1-3-15-14(16-7-6-12-18-11(2)19-22-12)17-10-13(21)20-8-4-5-9-20/h3-10H2,1-2H3,(H2,15,16,17) |
| InChIKey | QXVDYVZSEBEVEQ-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 95.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|