C17H30IN5OS — CID 111532840
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111532840) has the molecular formula C17H30IN5OS and a molecular weight of 479.43 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111532840 |
| Molecular Formula | C17H30IN5OS |
| Molecular Weight | 479.43 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-(2-oxo-2-piperidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)N1CCCCC1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C17H29N5OS.HI/c1-3-14-12-20-15(24-14)8-9-19-17(18-4-2)21-13-16(23)22-10-6-5-7-11-22;/h12H,3-11,13H2,1-2H3,(H2,18,19,21);1H |
| InChIKey | GHIHDNBOJYHIBR-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.43 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|