C16H30IN5O2S2 — CID 111533298
2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide (PubChem CID 111533298) has the molecular formula C16H30IN5O2S2 and a molecular weight of 515.49 g/mol. Its IUPAC name is 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111533298 |
| Molecular Formula | C16H30IN5O2S2 |
| Molecular Weight | 515.49 g/mol |
| Exact Mass | 515.09 |
| IUPAC Name | 2-[2-(1,1-dioxo-1,4-thiazinan-4-yl)ethyl]-1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCN1CCS(=O)(=O)CC1)NCCc1ncc(CC)s1.I |
| InChI | InChI=1S/C16H29N5O2S2.HI/c1-3-14-13-20-15(24-14)5-6-18-16(17-4-2)19-7-8-21-9-11-25(22,23)12-10-21;/h13H,3-12H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | PYGKPMCWTSPZRS-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 86.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.49 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|