C24H38N6S — CID 111532987
1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[4-(4-phenylpiperazin-1-yl)butyl]guanidine (PubChem CID 111532987) has the molecular formula C24H38N6S and a molecular weight of 442.68 g/mol. Its IUPAC name is 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[4-(4-phenylpiperazin-1-yl)butyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[4-(4-phenylpiperazin-1-yl)butyl]guanidine |
|---|---|
| PubChem CID | 111532987 |
| Molecular Formula | C24H38N6S |
| Molecular Weight | 442.68 g/mol |
| Exact Mass | 442.29 |
| IUPAC Name | 1-ethyl-3-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-[4-(4-phenylpiperazin-1-yl)butyl]guanidine |
| SMILES | CCN/C(=N\CCCCN1CCN(c2ccccc2)CC1)NCCc1ncc(CC)s1 |
| InChI | InChI=1S/C24H38N6S/c1-3-22-20-28-23(31-22)12-14-27-24(25-4-2)26-13-8-9-15-29-16-18-30(19-17-29)21-10-6-5-7-11-21/h5-7,10-11,20H,3-4,8-9,12-19H2,1-2H3,(H2,25,26,27) |
| InChIKey | NGDCVQYJIKDSHU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 55.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.68 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|