C21H30N6OS — CID 111533403
1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine (PubChem CID 111533403) has the molecular formula C21H30N6OS and a molecular weight of 414.58 g/mol. Its IUPAC name is 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine.
| Compound Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111533403 |
| Molecular Formula | C21H30N6OS |
| Molecular Weight | 414.58 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | 1-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-2-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine |
| SMILES | CCc1cnc(CCN/C(=N\C)NCC(=O)N2CCN(c3ccccc3)CC2)s1 |
| InChI | InChI=1S/C21H30N6OS/c1-3-18-15-24-19(29-18)9-10-23-21(22-2)25-16-20(28)27-13-11-26(12-14-27)17-7-5-4-6-8-17/h4-8,15H,3,9-14,16H2,1-2H3,(H2,22,23,25) |
| InChIKey | YBPLVTFDQGFPBQ-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.58 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|