C20H30IN5OS — CID 111532754
N-benzyl-N-ethyl-2-[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide (PubChem CID 111532754) has the molecular formula C20H30IN5OS and a molecular weight of 515.47 g/mol. Its IUPAC name is N-benzyl-N-ethyl-2-[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide.
| Compound Name | N-benzyl-N-ethyl-2-[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
|---|---|
| PubChem CID | 111532754 |
| Molecular Formula | C20H30IN5OS |
| Molecular Weight | 515.47 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | N-benzyl-N-ethyl-2-[[N-[2-(5-ethyl-1,3-thiazol-2-yl)ethyl]-N'-methylcarbamimidoyl]amino]acetamide;hydroiodide |
| SMILES | CCc1cnc(CCN/C(=N\C)NCC(=O)N(CC)Cc2ccccc2)s1.I |
| InChI | InChI=1S/C20H29N5OS.HI/c1-4-17-13-23-18(27-17)11-12-22-20(21-3)24-14-19(26)25(5-2)15-16-9-7-6-8-10-16;/h6-10,13H,4-5,11-12,14-15H2,1-3H3,(H2,21,22,24);1H |
| InChIKey | SCDUSAPXQDSDLY-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 69.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.47 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|