C17H28IN5O — CID 111228438
2-methyl-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-propylguanidine;hydroiodide (PubChem CID 111228438) has the molecular formula C17H28IN5O and a molecular weight of 445.35 g/mol. Its IUPAC name is 2-methyl-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-propylguanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-propylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111228438 |
| Molecular Formula | C17H28IN5O |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.13 |
| IUPAC Name | 2-methyl-1-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]-3-propylguanidine;hydroiodide |
| SMILES | CCCN/C(=N\C)NCC(=O)N1CCN(c2ccccc2)CC1.I |
| InChI | InChI=1S/C17H27N5O.HI/c1-3-9-19-17(18-2)20-14-16(23)22-12-10-21(11-13-22)15-7-5-4-6-8-15;/h4-8H,3,9-14H2,1-2H3,(H2,18,19,20);1H |
| InChIKey | UXHNPFUBKAHWLY-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|