C22H29FIN5O — CID 111845326
1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide (PubChem CID 111845326) has the molecular formula C22H29FIN5O and a molecular weight of 525.41 g/mol. Its IUPAC name is 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide.
| Compound Name | 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111845326 |
| Molecular Formula | C22H29FIN5O |
| Molecular Weight | 525.41 g/mol |
| Exact Mass | 525.14 |
| IUPAC Name | 1-[(3-fluoro-4-methylphenyl)methyl]-2-methyl-3-[2-oxo-2-(4-phenylpiperazin-1-yl)ethyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(=O)N1CCN(c2ccccc2)CC1)NCc1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C22H28FN5O.HI/c1-17-8-9-18(14-20(17)23)15-25-22(24-2)26-16-21(29)28-12-10-27(11-13-28)19-6-4-3-5-7-19;/h3-9,14H,10-13,15-16H2,1-2H3,(H2,24,25,26);1H |
| InChIKey | VGKNPIZZLRQUHW-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 59.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.41 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|