C21H26FIN4O — CID 111845224
1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[(3-fluoro-4-methylphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111845224) has the molecular formula C21H26FIN4O and a molecular weight of 496.37 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[(3-fluoro-4-methylphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[(3-fluoro-4-methylphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111845224 |
| Molecular Formula | C21H26FIN4O |
| Molecular Weight | 496.37 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[(3-fluoro-4-methylphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(=O)N1CCCc2ccccc21)NCc1ccc(C)c(F)c1.I |
| InChI | InChI=1S/C21H25FN4O.HI/c1-15-9-10-16(12-18(15)22)13-24-21(23-2)25-14-20(27)26-11-5-7-17-6-3-4-8-19(17)26;/h3-4,6,8-10,12H,5,7,11,13-14H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | YXXHONXPMXUBDC-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.37 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|