C21H27IN4O2 — CID 111183033
1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide (PubChem CID 111183033) has the molecular formula C21H27IN4O2 and a molecular weight of 494.38 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111183033 |
| Molecular Formula | C21H27IN4O2 |
| Molecular Weight | 494.38 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-3-[(4-methoxyphenyl)methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCC(=O)N1CCCc2ccccc21)NCc1ccc(OC)cc1.I |
| InChI | InChI=1S/C21H26N4O2.HI/c1-22-21(23-14-16-9-11-18(27-2)12-10-16)24-15-20(26)25-13-5-7-17-6-3-4-8-19(17)25;/h3-4,6,8-12H,5,7,13-15H2,1-2H3,(H2,22,23,24);1H |
| InChIKey | OGOYEWLUHXXYEJ-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.38 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|