C21H24F3IN4O — CID 111267082
1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111267082) has the molecular formula C21H24F3IN4O and a molecular weight of 532.35 g/mol. Its IUPAC name is 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111267082 |
| Molecular Formula | C21H24F3IN4O |
| Molecular Weight | 532.35 g/mol |
| Exact Mass | 532.09 |
| IUPAC Name | 1-[2-(3,4-dihydro-2H-quinolin-1-yl)-2-oxoethyl]-2-methyl-3-[[3-(trifluoromethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCC(=O)N1CCCc2ccccc21)NCc1cccc(C(F)(F)F)c1.I |
| InChI | InChI=1S/C21H23F3N4O.HI/c1-25-20(26-13-15-6-4-9-17(12-15)21(22,23)24)27-14-19(29)28-11-5-8-16-7-2-3-10-18(16)28;/h2-4,6-7,9-10,12H,5,8,11,13-14H2,1H3,(H2,25,26,27);1H |
| InChIKey | XWQCVVOFRCVYDA-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.35 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|