C22H27ClIN5O3 — CID 111846404
1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-methylguanidine;hydroiodide (PubChem CID 111846404) has the molecular formula C22H27ClIN5O3 and a molecular weight of 571.85 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111846404 |
| Molecular Formula | C22H27ClIN5O3 |
| Molecular Weight | 571.85 g/mol |
| Exact Mass | 571.08 |
| IUPAC Name | 1-(1,3-benzodioxol-5-ylmethyl)-3-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCC(=O)N1CCN(c2ccc(Cl)cc2)CC1)NCc1ccc2c(c1)OCO2.I |
| InChI | InChI=1S/C22H26ClN5O3.HI/c1-24-22(25-13-16-2-7-19-20(12-16)31-15-30-19)26-14-21(29)28-10-8-27(9-11-28)18-5-3-17(23)4-6-18;/h2-7,12H,8-11,13-15H2,1H3,(H2,24,25,26);1H |
| InChIKey | UHJBGOJBQBXNAY-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.85 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|