C19H25ClN6OS — CID 111523960
1-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine (PubChem CID 111523960) has the molecular formula C19H25ClN6OS and a molecular weight of 420.97 g/mol. Its IUPAC name is 1-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine.
| Compound Name | 1-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111523960 |
| Molecular Formula | C19H25ClN6OS |
| Molecular Weight | 420.97 g/mol |
| Exact Mass | 420.15 |
| IUPAC Name | 1-[2-[4-(4-chlorophenyl)piperazin-1-yl]-2-oxoethyl]-2-methyl-3-[(5-methyl-1,3-thiazol-2-yl)methyl]guanidine |
| SMILES | C/N=C(/NCC(=O)N1CCN(c2ccc(Cl)cc2)CC1)NCc1ncc(C)s1 |
| InChI | InChI=1S/C19H25ClN6OS/c1-14-11-22-17(28-14)12-23-19(21-2)24-13-18(27)26-9-7-25(8-10-26)16-5-3-15(20)4-6-16/h3-6,11H,7-10,12-13H2,1-2H3,(H2,21,23,24) |
| InChIKey | APWXGCKCUIRRLZ-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 72.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.97 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|