C19H32N6OS — CID 111520823
4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111520823) has the molecular formula C19H32N6OS and a molecular weight of 392.57 g/mol. Its IUPAC name is 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111520823 |
| Molecular Formula | C19H32N6OS |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.24 |
| IUPAC Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(5-methyl-1,3-thiazol-2-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCc1ncc(C)s1)N1CCN(CC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C19H32N6OS/c1-16-13-21-17(27-16)14-22-19(20-2)25-11-9-23(10-12-25)15-18(26)24-7-5-3-4-6-8-24/h13H,3-12,14-15H2,1-2H3,(H,20,22) |
| InChIKey | HBUWMVOOAZMZAZ-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 64.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|