C19H36N6O2 — CID 119134014
2-[[C-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-propan-2-ylacetamide (PubChem CID 119134014) has the molecular formula C19H36N6O2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-[[C-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-propan-2-ylacetamide.
| Compound Name | 2-[[C-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-propan-2-ylacetamide |
|---|---|
| PubChem CID | 119134014 |
| Molecular Formula | C19H36N6O2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | 2-[[C-[4-[2-(azepan-1-yl)-2-oxoethyl]piperazin-1-yl]-N-methylcarbonimidoyl]amino]-N-propan-2-ylacetamide |
| SMILES | C/N=C(\NCC(=O)NC(C)C)N1CCN(CC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C19H36N6O2/c1-16(2)22-17(26)14-21-19(20-3)25-12-10-23(11-13-25)15-18(27)24-8-6-4-5-7-9-24/h16H,4-15H2,1-3H3,(H,20,21)(H,22,26) |
| InChIKey | JNNSKCWMZRBMQN-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 80.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|