C21H39N5O2S — CID 111520845
4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111520845) has the molecular formula C21H39N5O2S and a molecular weight of 425.64 g/mol. Its IUPAC name is 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111520845 |
| Molecular Formula | C21H39N5O2S |
| Molecular Weight | 425.64 g/mol |
| Exact Mass | 425.28 |
| IUPAC Name | 4-[2-(azepan-1-yl)-2-oxoethyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(SC)CCOCC1)N1CCN(CC(=O)N2CCCCCC2)CC1 |
| InChI | InChI=1S/C21H39N5O2S/c1-22-20(23-18-21(29-2)7-15-28-16-8-21)26-13-11-24(12-14-26)17-19(27)25-9-5-3-4-6-10-25/h3-18H2,1-2H3,(H,22,23) |
| InChIKey | XCPBKWGEMVTRPL-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.64 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|