C22H41N5O2S — CID 111520649
4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide (PubChem CID 111520649) has the molecular formula C22H41N5O2S and a molecular weight of 439.67 g/mol. Its IUPAC name is 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide.
| Compound Name | 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111520649 |
| Molecular Formula | C22H41N5O2S |
| Molecular Weight | 439.67 g/mol |
| Exact Mass | 439.30 |
| IUPAC Name | 4-[2-(3,5-dimethylpiperidin-1-yl)-2-oxoethyl]-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(SC)CCOCC1)N1CCN(CC(=O)N2CC(C)CC(C)C2)CC1 |
| InChI | InChI=1S/C22H41N5O2S/c1-18-13-19(2)15-27(14-18)20(28)16-25-7-9-26(10-8-25)21(23-3)24-17-22(30-4)5-11-29-12-6-22/h18-19H,5-17H2,1-4H3,(H,23,24) |
| InChIKey | ANBOFSOANVLUSP-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 60.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.67 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|