C20H33IN4O2S — CID 111514485
4-(3-methoxyphenyl)-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide (PubChem CID 111514485) has the molecular formula C20H33IN4O2S and a molecular weight of 520.48 g/mol. Its IUPAC name is 4-(3-methoxyphenyl)-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide.
| Compound Name | 4-(3-methoxyphenyl)-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 111514485 |
| Molecular Formula | C20H33IN4O2S |
| Molecular Weight | 520.48 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 4-(3-methoxyphenyl)-N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]piperazine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1(SC)CCOCC1)N1CCN(c2cccc(OC)c2)CC1.I |
| InChI | InChI=1S/C20H32N4O2S.HI/c1-21-19(22-16-20(27-3)7-13-26-14-8-20)24-11-9-23(10-12-24)17-5-4-6-18(15-17)25-2;/h4-6,15H,7-14,16H2,1-3H3,(H,21,22);1H |
| InChIKey | IHQYZCPIHDZNHC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|