C21H31F3N4OS — CID 111517302
N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboximidamide (PubChem CID 111517302) has the molecular formula C21H31F3N4OS and a molecular weight of 444.57 g/mol. Its IUPAC name is N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboximidamide.
| Compound Name | N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboximidamide |
|---|---|
| PubChem CID | 111517302 |
| Molecular Formula | C21H31F3N4OS |
| Molecular Weight | 444.57 g/mol |
| Exact Mass | 444.22 |
| IUPAC Name | N'-methyl-N-[(4-methylsulfanyloxan-4-yl)methyl]-4-[[3-(trifluoromethyl)phenyl]methyl]piperazine-1-carboximidamide |
| SMILES | C/N=C(\NCC1(SC)CCOCC1)N1CCN(Cc2cccc(C(F)(F)F)c2)CC1 |
| InChI | InChI=1S/C21H31F3N4OS/c1-25-19(26-16-20(30-2)6-12-29-13-7-20)28-10-8-27(9-11-28)15-17-4-3-5-18(14-17)21(22,23)24/h3-5,14H,6-13,15-16H2,1-2H3,(H,25,26) |
| InChIKey | HPJRIBAXYRADQB-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.57 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|