C25H33FN4O — CID 110959505
4-benzyl-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-N'-methylpiperazine-1-carboximidamide (PubChem CID 110959505) has the molecular formula C25H33FN4O and a molecular weight of 424.56 g/mol. Its IUPAC name is 4-benzyl-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-N'-methylpiperazine-1-carboximidamide.
| Compound Name | 4-benzyl-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-N'-methylpiperazine-1-carboximidamide |
|---|---|
| PubChem CID | 110959505 |
| Molecular Formula | C25H33FN4O |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | 4-benzyl-N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-N'-methylpiperazine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(c2ccc(F)cc2)CCOCC1)N1CCN(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C25H33FN4O/c1-27-24(30-15-13-29(14-16-30)19-21-5-3-2-4-6-21)28-20-25(11-17-31-18-12-25)22-7-9-23(26)10-8-22/h2-10H,11-20H2,1H3,(H,27,28) |
| InChIKey | RYMLMBAALWFZAO-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 40.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|