C25H34IN3O2 — CID 109427728
N'-methyl-4-phenoxy-N-[(4-phenyloxan-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide (PubChem CID 109427728) has the molecular formula C25H34IN3O2 and a molecular weight of 535.47 g/mol. Its IUPAC name is N'-methyl-4-phenoxy-N-[(4-phenyloxan-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-4-phenoxy-N-[(4-phenyloxan-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109427728 |
| Molecular Formula | C25H34IN3O2 |
| Molecular Weight | 535.47 g/mol |
| Exact Mass | 535.17 |
| IUPAC Name | N'-methyl-4-phenoxy-N-[(4-phenyloxan-4-yl)methyl]piperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(/NCC1(c2ccccc2)CCOCC1)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C25H33N3O2.HI/c1-26-24(28-16-12-23(13-17-28)30-22-10-6-3-7-11-22)27-20-25(14-18-29-19-15-25)21-8-4-2-5-9-21;/h2-11,23H,12-20H2,1H3,(H,26,27);1H |
| InChIKey | SCCYKXHJRAAMAG-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.47 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|