C18H28IN3O2 — CID 109427130
N'-methyl-N-(oxolan-2-ylmethyl)-4-phenoxypiperidine-1-carboximidamide;hydroiodide (PubChem CID 109427130) has the molecular formula C18H28IN3O2 and a molecular weight of 445.35 g/mol. Its IUPAC name is N'-methyl-N-(oxolan-2-ylmethyl)-4-phenoxypiperidine-1-carboximidamide;hydroiodide.
| Compound Name | N'-methyl-N-(oxolan-2-ylmethyl)-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
|---|---|
| PubChem CID | 109427130 |
| Molecular Formula | C18H28IN3O2 |
| Molecular Weight | 445.35 g/mol |
| Exact Mass | 445.12 |
| IUPAC Name | N'-methyl-N-(oxolan-2-ylmethyl)-4-phenoxypiperidine-1-carboximidamide;hydroiodide |
| SMILES | C/N=C(\NCC1CCCO1)N1CCC(Oc2ccccc2)CC1.I |
| InChI | InChI=1S/C18H27N3O2.HI/c1-19-18(20-14-17-8-5-13-22-17)21-11-9-16(10-12-21)23-15-6-3-2-4-7-15;/h2-4,6-7,16-17H,5,8-14H2,1H3,(H,19,20);1H |
| InChIKey | GECCWYUTAMNRET-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|