C25H30FN3O — CID 111263107
N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide (PubChem CID 111263107) has the molecular formula C25H30FN3O and a molecular weight of 407.53 g/mol. Its IUPAC name is N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide.
| Compound Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
|---|---|
| PubChem CID | 111263107 |
| Molecular Formula | C25H30FN3O |
| Molecular Weight | 407.53 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | N-[[4-(4-fluorophenyl)oxan-4-yl]methyl]-N'-methyl-4-phenyl-3,6-dihydro-2H-pyridine-1-carboximidamide |
| SMILES | C/N=C(/NCC1(c2ccc(F)cc2)CCOCC1)N1CC=C(c2ccccc2)CC1 |
| InChI | InChI=1S/C25H30FN3O/c1-27-24(29-15-11-21(12-16-29)20-5-3-2-4-6-20)28-19-25(13-17-30-18-14-25)22-7-9-23(26)10-8-22/h2-11H,12-19H2,1H3,(H,27,28) |
| InChIKey | JRRSSEQGIXICSN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 36.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.53 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|