C26H37IN4O — CID 111394316
2-methyl-1-[(4-phenyloxan-4-yl)methyl]-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111394316) has the molecular formula C26H37IN4O and a molecular weight of 548.51 g/mol. Its IUPAC name is 2-methyl-1-[(4-phenyloxan-4-yl)methyl]-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(4-phenyloxan-4-yl)methyl]-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111394316 |
| Molecular Formula | C26H37IN4O |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.20 |
| IUPAC Name | 2-methyl-1-[(4-phenyloxan-4-yl)methyl]-3-[[4-(pyrrolidin-1-ylmethyl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(CN2CCCC2)cc1)NCC1(c2ccccc2)CCOCC1.I |
| InChI | InChI=1S/C26H36N4O.HI/c1-27-25(28-19-22-9-11-23(12-10-22)20-30-15-5-6-16-30)29-21-26(13-17-31-18-14-26)24-7-3-2-4-8-24;/h2-4,7-12H,5-6,13-21H2,1H3,(H2,27,28,29);1H |
| InChIKey | KRKZEPYSCISQGE-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|